C13H18N2 — CID 143140664
2-(1,4-dimethylpyrrol-2-yl)pyridine;ethane (PubChem CID 143140664) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-(1,4-dimethylpyrrol-2-yl)pyridine;ethane.
| Compound Name | 2-(1,4-dimethylpyrrol-2-yl)pyridine;ethane |
|---|---|
| PubChem CID | 143140664 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 2-(1,4-dimethylpyrrol-2-yl)pyridine;ethane |
| SMILES | CC.Cc1cc(-c2ccccn2)n(C)c1 |
| InChI | InChI=1S/C11H12N2.C2H6/c1-9-7-11(13(2)8-9)10-5-3-4-6-12-10;1-2/h3-8H,1-2H3;1-2H3 |
| InChIKey | MJLLEOVCFLYNSD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |