C13H21N3 — CID 167606075
1,5-dimethylpyrazole;2,4-dimethylpyridine;methane (PubChem CID 167606075) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 1,5-dimethylpyrazole;2,4-dimethylpyridine;methane.
| Compound Name | 1,5-dimethylpyrazole;2,4-dimethylpyridine;methane |
|---|---|
| PubChem CID | 167606075 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 1,5-dimethylpyrazole;2,4-dimethylpyridine;methane |
| SMILES | C.Cc1ccnc(C)c1.Cc1ccnn1C |
| InChI | InChI=1S/C7H9N.C5H8N2.CH4/c1-6-3-4-8-7(2)5-6;1-5-3-4-6-7(5)2;/h3-5H,1-2H3;3-4H,1-2H3;1H4 |
| InChIKey | KKADAOOHJRYTOD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |