About 1,5-dimethylpyrazole;2,4-dimethylpyridine;methane
1,5-dimethylpyrazole;2,4-dimethylpyridine;methane (PubChem CID 167606075) has the molecular formula C13H21N3
and a molecular weight of 219.33 g/mol. Its IUPAC name is 1,5-dimethylpyrazole;2,4-dimethylpyridine;methane.
Molecular Properties
| Compound Name | 1,5-dimethylpyrazole;2,4-dimethylpyridine;methane |
| PubChem CID | 167606075 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 1,5-dimethylpyrazole;2,4-dimethylpyridine;methane |
| SMILES | C.Cc1ccnc(C)c1.Cc1ccnn1C |
| InChI | InChI=1S/C7H9N.C5H8N2.CH4/c1-6-3-4-8-7(2)5-6;1-5-3-4-6-7(5)2;/h3-5H,1-2H3;3-4H,1-2H3;1H4 |
| InChIKey | KKADAOOHJRYTOD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,5-dimethylpyrazole;2,4-dimethylpyridine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethylpyrazole;2,4-dimethylpyridine;methane?
The IUPAC name of 1,5-dimethylpyrazole;2,4-dimethylpyridine;methane (CID 167606075) is 1,5-dimethylpyrazole;2,4-dimethylpyridine;methane.
What is the SMILES notation for 1,5-dimethylpyrazole;2,4-dimethylpyridine;methane?
The canonical SMILES for 1,5-dimethylpyrazole;2,4-dimethylpyridine;methane is C.Cc1ccnc(C)c1.Cc1ccnn1C.
What is the InChIKey of 1,5-dimethylpyrazole;2,4-dimethylpyridine;methane?
The InChIKey is KKADAOOHJRYTOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C5H8N2.CH4/c1-6-3-4-8-7(2)5-6;1-5-3-4-6-7(5)2;/h3-5H,1-2H3;3-4H,1-2H3;1H4.
What are the key properties of 1,5-dimethylpyrazole;2,4-dimethylpyridine;methane?
1,5-dimethylpyrazole;2,4-dimethylpyridine;methane has a molecular weight of 219.33 g/mol, XLogP of 3.06, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethylpyrazole;2,4-dimethylpyridine;methane is sourced from PubChem (CID 167606075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).