C11H13N3 — CID 139386235
2-(2,5-dimethylpyrazol-3-yl)-4-methylpyridine (PubChem CID 139386235) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrazol-3-yl)-4-methylpyridine.
| Compound Name | 2-(2,5-dimethylpyrazol-3-yl)-4-methylpyridine |
|---|---|
| PubChem CID | 139386235 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 2-(2,5-dimethylpyrazol-3-yl)-4-methylpyridine |
| SMILES | Cc1ccnc(-c2cc(C)nn2C)c1 |
| InChI | InChI=1S/C11H13N3/c1-8-4-5-12-10(6-8)11-7-9(2)13-14(11)3/h4-7H,1-3H3 |
| InChIKey | HFONOBHMCKPVHT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |