About 4-methyl-2-(4-methyl-2-pyridinyl)pyridine;oxovanadium
4-methyl-2-(4-methyl-2-pyridinyl)pyridine;oxovanadium (PubChem CID 139924983) has the molecular formula C12H12N2OV
and a molecular weight of 251.19 g/mol. Its IUPAC name is 4-methyl-2-(4-methyl-2-pyridinyl)pyridine;oxovanadium.
Molecular Properties
| Compound Name | 4-methyl-2-(4-methyl-2-pyridinyl)pyridine;oxovanadium |
| PubChem CID | 139924983 |
| Molecular Formula | C12H12N2OV |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 4-methyl-2-(4-methyl-2-pyridinyl)pyridine;oxovanadium |
| SMILES | Cc1ccnc(-c2cc(C)ccn2)c1.O=[V] |
| InChI | InChI=1S/C12H12N2.O.V/c1-9-3-5-13-11(7-9)12-8-10(2)4-6-14-12;;/h3-8H,1-2H3;; |
| InChIKey | OYTYGCMJOADLOT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-2-(4-methyl-2-pyridinyl)pyridine;oxovanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-(4-methyl-2-pyridinyl)pyridine;oxovanadium?
The IUPAC name of 4-methyl-2-(4-methyl-2-pyridinyl)pyridine;oxovanadium (CID 139924983) is 4-methyl-2-(4-methyl-2-pyridinyl)pyridine;oxovanadium.
What is the SMILES notation for 4-methyl-2-(4-methyl-2-pyridinyl)pyridine;oxovanadium?
The canonical SMILES for 4-methyl-2-(4-methyl-2-pyridinyl)pyridine;oxovanadium is Cc1ccnc(-c2cc(C)ccn2)c1.O=[V].
What is the InChIKey of 4-methyl-2-(4-methyl-2-pyridinyl)pyridine;oxovanadium?
The InChIKey is OYTYGCMJOADLOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.O.V/c1-9-3-5-13-11(7-9)12-8-10(2)4-6-14-12;;/h3-8H,1-2H3;;.
What are the key properties of 4-methyl-2-(4-methyl-2-pyridinyl)pyridine;oxovanadium?
4-methyl-2-(4-methyl-2-pyridinyl)pyridine;oxovanadium has a molecular weight of 251.19 g/mol, XLogP of 2.64, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(4-methyl-2-pyridinyl)pyridine;oxovanadium is sourced from PubChem (CID 139924983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).