C15H34N2 — CID 142280941
butane;1,5-dimethylpyrazole;ethane (PubChem CID 142280941) has the molecular formula C15H34N2 and a molecular weight of 242.45 g/mol. Its IUPAC name is butane;1,5-dimethylpyrazole;ethane.
| Compound Name | butane;1,5-dimethylpyrazole;ethane |
|---|---|
| PubChem CID | 142280941 |
| Molecular Formula | C15H34N2 |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.27 |
| IUPAC Name | butane;1,5-dimethylpyrazole;ethane |
| SMILES | CC.CCCC.CCCC.Cc1ccnn1C |
| InChI | InChI=1S/C5H8N2.2C4H10.C2H6/c1-5-3-4-6-7(5)2;2*1-3-4-2;1-2/h3-4H,1-2H3;2*3-4H2,1-2H3;1-2H3 |
| InChIKey | FJFNRXTYCDTREO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |