C8H14N2O — CID 145471849
2,4-dimethylpyridazin-3-one;ethane (PubChem CID 145471849) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 2,4-dimethylpyridazin-3-one;ethane.
| Compound Name | 2,4-dimethylpyridazin-3-one;ethane |
|---|---|
| PubChem CID | 145471849 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 2,4-dimethylpyridazin-3-one;ethane |
| SMILES | CC.Cc1ccnn(C)c1=O |
| InChI | InChI=1S/C6H8N2O.C2H6/c1-5-3-4-7-8(2)6(5)9;1-2/h3-4H,1-2H3;1-2H3 |
| InChIKey | GWUZLVGAZDXVHC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |