C26H23IrN2- — CID 59358830
2,6-dimethyl-3-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium (PubChem CID 59358830) has the molecular formula C26H23IrN2- and a molecular weight of 555.70 g/mol. Its IUPAC name is 2,6-dimethyl-3-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium.
| Compound Name | 2,6-dimethyl-3-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
|---|---|
| PubChem CID | 59358830 |
| Molecular Formula | C26H23IrN2- |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | 2,6-dimethyl-3-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
| SMILES | Cc1cc(C)c(-c2c(C)nc3c4[c-]cccc4c4ccc(C)cc4n23)c(C)c1.[Ir] |
| InChI | InChI=1S/C26H23N2.Ir/c1-15-10-11-21-20-8-6-7-9-22(20)26-27-19(5)25(28(26)23(21)14-15)24-17(3)12-16(2)13-18(24)4;/h6-8,10-14H,1-5H3;/q-1; |
| InChIKey | LNMPDUXUILQNGR-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|