C16H10FIrN2- — CID 59358238
6-fluoro-3-methyl-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium (PubChem CID 59358238) has the molecular formula C16H10FIrN2- and a molecular weight of 441.49 g/mol. Its IUPAC name is 6-fluoro-3-methyl-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium.
| Compound Name | 6-fluoro-3-methyl-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
|---|---|
| PubChem CID | 59358238 |
| Molecular Formula | C16H10FIrN2- |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 6-fluoro-3-methyl-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
| SMILES | Cc1cnc2c3[c-]cccc3c3ccc(F)cc3n12.[Ir] |
| InChI | InChI=1S/C16H10FN2.Ir/c1-10-9-18-16-14-5-3-2-4-12(14)13-7-6-11(17)8-15(13)19(10)16;/h2-4,6-9H,1H3;/q-1; |
| InChIKey | YUBWWIWVAIBITC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|