C31H33ClMgN2 — CID 58163278
magnesium;3-(2,6-dimethylphenyl)-6,7-bis(2-methylpropyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;chloride (PubChem CID 58163278) has the molecular formula C31H33ClMgN2 and a molecular weight of 493.38 g/mol. Its IUPAC name is magnesium;3-(2,6-dimethylphenyl)-6,7-bis(2-methylpropyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;chloride.
| Compound Name | magnesium;3-(2,6-dimethylphenyl)-6,7-bis(2-methylpropyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;chloride |
|---|---|
| PubChem CID | 58163278 |
| Molecular Formula | C31H33ClMgN2 |
| Molecular Weight | 493.38 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | magnesium;3-(2,6-dimethylphenyl)-6,7-bis(2-methylpropyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;chloride |
| SMILES | Cc1cccc(C)c1-c1cnc2c3[c-]cccc3c3cc(CC(C)C)c(CC(C)C)cc3n12.[Cl-].[Mg+2] |
| InChI | InChI=1S/C31H33N2.ClH.Mg/c1-19(2)14-23-16-27-25-12-7-8-13-26(25)31-32-18-29(30-21(5)10-9-11-22(30)6)33(31)28(27)17-24(23)15-20(3)4;;/h7-12,16-20H,14-15H2,1-6H3;1H;/q-1;;+2/p-1 |
| InChIKey | OHFNDXVFQLVBSP-UHFFFAOYSA-M |
| XLogP | 4.74 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|