C26H25IrN2O- — CID 58262191
CID 58262191 (PubChem CID 58262191) has the molecular formula C26H25IrN2O- and a molecular weight of 573.72 g/mol.
| Compound Name | CID 58262191 |
|---|---|
| PubChem CID | 58262191 |
| Molecular Formula | C26H25IrN2O- |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | — |
| SMILES | Cc1cc2c(o1)c1ccc[c-]c1c1ncc(-c3c(C(C)C)cccc3C(C)C)n21.[Ir] |
| InChI | InChI=1S/C26H25N2O.Ir/c1-15(2)18-11-8-12-19(16(3)4)24(18)23-14-27-26-21-10-7-6-9-20(21)25-22(28(23)26)13-17(5)29-25;/h6-9,11-16H,1-5H3;/q-1; |
| InChIKey | QAFZJDGBWKHCCC-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 30.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|