C43H38IrN5O — CID 140637831
CID 140637831 (PubChem CID 140637831) has the molecular formula C43H38IrN5O and a molecular weight of 833.03 g/mol.
| Compound Name | CID 140637831 |
|---|---|
| PubChem CID | 140637831 |
| Molecular Formula | C43H38IrN5O |
| Molecular Weight | 833.03 g/mol |
| Exact Mass | 833.27 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cnc2c3[c-]cccc3c3ccccc3n12.CCN1C=NN(c2[c-]ccc3c2oc2ccccc23)[CH-]1.[Ir+3] |
| InChI | InChI=1S/C27H25N2.C16H13N3O.Ir/c1-17(2)19-13-9-14-20(18(3)4)26(19)25-16-28-27-23-12-6-5-10-21(23)22-11-7-8-15-24(22)29(25)27;1-2-18-10-17-19(11-18)14-8-5-7-13-12-6-3-4-9-15(12)20-16(13)14;/h5-11,13-18H,1-4H3;3-7,9-11H,2H2,1H3;/q-1;-2;+3 |
| InChIKey | JILCUVWZXVPPSF-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.03 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|