C39H40IrN5O — CID 146934129
CID 146934129 (PubChem CID 146934129) has the molecular formula C39H40IrN5O and a molecular weight of 787.00 g/mol.
| Compound Name | CID 146934129 |
|---|---|
| PubChem CID | 146934129 |
| Molecular Formula | C39H40IrN5O |
| Molecular Weight | 787.00 g/mol |
| Exact Mass | 787.29 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1ccnc1-c1[c-]cccc1.Cc1cccc2c1oc1c(N3[CH-]N(C(C)C)C=N3)[c-]ccc12.[Ir+3] |
| InChI | InChI=1S/C21H23N2.C18H17N3O.Ir/c1-15(2)18-11-8-12-19(16(3)4)20(18)23-14-13-22-21(23)17-9-6-5-7-10-17;1-12(2)20-10-19-21(11-20)16-9-5-8-15-14-7-4-6-13(3)17(14)22-18(15)16;/h5-9,11-16H,1-4H3;4-8,10-12H,1-3H3;/q-1;-2;+3 |
| InChIKey | JNXKWPPCBGOKTA-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 49.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.00 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|