C44H40IrN5O2 — CID 140637851
CID 140637851 (PubChem CID 140637851) has the molecular formula C44H40IrN5O2 and a molecular weight of 863.05 g/mol.
| Compound Name | CID 140637851 |
|---|---|
| PubChem CID | 140637851 |
| Molecular Formula | C44H40IrN5O2 |
| Molecular Weight | 863.05 g/mol |
| Exact Mass | 863.28 |
| IUPAC Name | — |
| SMILES | CC(C)N1C=NN(c2[c-]ccc3c2oc2ccccc23)[CH-]1.CC(C)c1cc2c(oc3ccccc32)c(C(C)C)c1-n1ccnc1-c1[c-]cccc1.[Ir+3] |
| InChI | InChI=1S/C27H25N2O.C17H15N3O.Ir/c1-17(2)21-16-22-20-12-8-9-13-23(20)30-26(22)24(18(3)4)25(21)29-15-14-28-27(29)19-10-6-5-7-11-19;1-12(2)19-10-18-20(11-19)15-8-5-7-14-13-6-3-4-9-16(13)21-17(14)15;/h5-10,12-18H,1-4H3;3-7,9-12H,1-2H3;/q-1;-2;+3 |
| InChIKey | GYCXIBYTFVMPNP-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 62.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.05 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|