C42H36IrN3O- — CID 162462430
1-(3H-dibenzofuran-3-id-4-yl)-3-[2,6-di(propan-2-yl)phenyl]benzimidazol-3-ium;iridium;2-phenylpyridine (PubChem CID 162462430) has the molecular formula C42H36IrN3O- and a molecular weight of 790.99 g/mol. Its IUPAC name is 1-(3H-dibenzofuran-3-id-4-yl)-3-[2,6-di(propan-2-yl)phenyl]benzimidazol-3-ium;iridium;2-phenylpyridine.
| Compound Name | 1-(3H-dibenzofuran-3-id-4-yl)-3-[2,6-di(propan-2-yl)phenyl]benzimidazol-3-ium;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 162462430 |
| Molecular Formula | C42H36IrN3O- |
| Molecular Weight | 790.99 g/mol |
| Exact Mass | 791.25 |
| IUPAC Name | 1-(3H-dibenzofuran-3-id-4-yl)-3-[2,6-di(propan-2-yl)phenyl]benzimidazol-3-ium;iridium;2-phenylpyridine |
| SMILES | CC(C)c1cccc(C(C)C)c1-[n+]1cn(-c2[c-]ccc3c2oc2ccccc23)c2ccccc21.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C31H28N2O.C11H8N.Ir/c1-20(2)22-12-9-13-23(21(3)4)30(22)33-19-32(26-15-6-7-16-27(26)33)28-17-10-14-25-24-11-5-8-18-29(24)34-31(25)28;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-16,18-21H,1-4H3;1-6,8-9H;/q;-1; |
| InChIKey | HXAIMBXXRAEDSO-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.99 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|