C35H41IrN2- — CID 58162565
7-(2,2-dimethylpropyl)-3-[2,4,6-tri(propan-2-yl)phenyl]-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium (PubChem CID 58162565) has the molecular formula C35H41IrN2- and a molecular weight of 681.94 g/mol. Its IUPAC name is 7-(2,2-dimethylpropyl)-3-[2,4,6-tri(propan-2-yl)phenyl]-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium.
| Compound Name | 7-(2,2-dimethylpropyl)-3-[2,4,6-tri(propan-2-yl)phenyl]-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
|---|---|
| PubChem CID | 58162565 |
| Molecular Formula | C35H41IrN2- |
| Molecular Weight | 681.94 g/mol |
| Exact Mass | 682.29 |
| IUPAC Name | 7-(2,2-dimethylpropyl)-3-[2,4,6-tri(propan-2-yl)phenyl]-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
| SMILES | CC(C)c1cc(C(C)C)c(-c2cnc3c4[c-]cccc4c4cc(CC(C)(C)C)ccc4n23)c(C(C)C)c1.[Ir] |
| InChI | InChI=1S/C35H41N2.Ir/c1-21(2)25-17-28(22(3)4)33(29(18-25)23(5)6)32-20-36-34-27-13-11-10-12-26(27)30-16-24(19-35(7,8)9)14-15-31(30)37(32)34;/h10-12,14-18,20-23H,19H2,1-9H3;/q-1; |
| InChIKey | LWUXEIAPFCVOPO-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.94 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|