C30H27IrN2- — CID 58943938
3-(2,6-dicyclopropyl-4-methylphenyl)-6,7-dimethyl-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium (PubChem CID 58943938) has the molecular formula C30H27IrN2- and a molecular weight of 607.78 g/mol. Its IUPAC name is 3-(2,6-dicyclopropyl-4-methylphenyl)-6,7-dimethyl-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium.
| Compound Name | 3-(2,6-dicyclopropyl-4-methylphenyl)-6,7-dimethyl-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
|---|---|
| PubChem CID | 58943938 |
| Molecular Formula | C30H27IrN2- |
| Molecular Weight | 607.78 g/mol |
| Exact Mass | 608.18 |
| IUPAC Name | 3-(2,6-dicyclopropyl-4-methylphenyl)-6,7-dimethyl-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
| SMILES | Cc1cc(C2CC2)c(-c2cnc3c4[c-]cccc4c4cc(C)c(C)cc4n23)c(C2CC2)c1.[Ir] |
| InChI | InChI=1S/C30H27N2.Ir/c1-17-12-24(20-8-9-20)29(25(13-17)21-10-11-21)28-16-31-30-23-7-5-4-6-22(23)26-14-18(2)19(3)15-27(26)32(28)30;/h4-6,12-16,20-21H,8-11H2,1-3H3;/q-1; |
| InChIKey | NAERFNZNSCJXJL-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.78 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|