C41H45IrN2- — CID 59365993
3-[2,6-bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phenyl]-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium (PubChem CID 59365993) has the molecular formula C41H45IrN2- and a molecular weight of 758.04 g/mol. Its IUPAC name is 3-[2,6-bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phenyl]-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium.
| Compound Name | 3-[2,6-bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phenyl]-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
|---|---|
| PubChem CID | 59365993 |
| Molecular Formula | C41H45IrN2- |
| Molecular Weight | 758.04 g/mol |
| Exact Mass | 758.32 |
| IUPAC Name | 3-[2,6-bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)phenyl]-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
| SMILES | CC1(C)C2CCC1(C)C(c1cccc(C3CC4CCC3(C)C4(C)C)c1-c1cnc3c4[c-]cccc4c4ccccc4n13)C2.[Ir] |
| InChI | InChI=1S/C41H45N2.Ir/c1-38(2)25-18-20-40(38,5)32(22-25)30-15-11-16-31(33-23-26-19-21-41(33,6)39(26,3)4)36(30)35-24-42-37-29-14-8-7-12-27(29)28-13-9-10-17-34(28)43(35)37;/h7-13,15-17,24-26,32-33H,18-23H2,1-6H3;/q-1; |
| InChIKey | FHFGYGSSXAQXMX-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.04 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|