C45H30F2IrN4-2 — CID 58162931
2,6-difluoro-3-pyridin-2-yl-4H-pyridin-4-ide;3-(2,6-diphenylphenyl)-6,7-dimethyl-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium (PubChem CID 58162931) has the molecular formula C45H30F2IrN4-2 and a molecular weight of 856.98 g/mol. Its IUPAC name is 2,6-difluoro-3-pyridin-2-yl-4H-pyridin-4-ide;3-(2,6-diphenylphenyl)-6,7-dimethyl-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium.
| Compound Name | 2,6-difluoro-3-pyridin-2-yl-4H-pyridin-4-ide;3-(2,6-diphenylphenyl)-6,7-dimethyl-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
|---|---|
| PubChem CID | 58162931 |
| Molecular Formula | C45H30F2IrN4-2 |
| Molecular Weight | 856.98 g/mol |
| Exact Mass | 857.21 |
| IUPAC Name | 2,6-difluoro-3-pyridin-2-yl-4H-pyridin-4-ide;3-(2,6-diphenylphenyl)-6,7-dimethyl-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
| SMILES | Cc1cc2c3ccc[c-]c3c3ncc(-c4c(-c5ccccc5)cccc4-c4ccccc4)n3c2cc1C.Fc1c[c-]c(-c2ccccn2)c(F)n1.[Ir] |
| InChI | InChI=1S/C35H25N2.C10H5F2N2.Ir/c1-23-20-31-29-16-9-10-17-30(29)35-36-22-33(37(35)32(31)21-24(23)2)34-27(25-12-5-3-6-13-25)18-11-19-28(34)26-14-7-4-8-15-26;11-9-5-4-7(10(12)14-9)8-3-1-2-6-13-8;/h3-16,18-22H,1-2H3;1-3,5-6H;/q2*-1; |
| InChIKey | LRUFZZIIHCRFCQ-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.98 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|