C10H5F2IrN2- — CID 177432309
2,6-difluoro-3-pyridin-2-yl-4H-pyridin-4-ide;iridium (PubChem CID 177432309) has the molecular formula C10H5F2IrN2- and a molecular weight of 383.38 g/mol. Its IUPAC name is 2,6-difluoro-3-pyridin-2-yl-4H-pyridin-4-ide;iridium.
| Compound Name | 2,6-difluoro-3-pyridin-2-yl-4H-pyridin-4-ide;iridium |
|---|---|
| PubChem CID | 177432309 |
| Molecular Formula | C10H5F2IrN2- |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 2,6-difluoro-3-pyridin-2-yl-4H-pyridin-4-ide;iridium |
| SMILES | Fc1c[c-]c(-c2ccccn2)c(F)n1.[Ir] |
| InChI | InChI=1S/C10H5F2N2.Ir/c11-9-5-4-7(10(12)14-9)8-3-1-2-6-13-8;/h1-3,5-6H;/q-1; |
| InChIKey | PMEAXCZZCZNFBZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|