C19H22F2IrN7 — CID 153420867
2,6-difluoro-3-pyridin-2-yl-4H-pyridin-4-ide;iridium(3+);propan-2-yl-[propan-2-ylazanidyl(1,2,4-triazol-1-yl)methyl]azanide (PubChem CID 153420867) has the molecular formula C19H22F2IrN7 and a molecular weight of 578.65 g/mol. Its IUPAC name is 2,6-difluoro-3-pyridin-2-yl-4H-pyridin-4-ide;iridium(3+);propan-2-yl-[propan-2-ylazanidyl(1,2,4-triazol-1-yl)methyl]azanide.
| Compound Name | 2,6-difluoro-3-pyridin-2-yl-4H-pyridin-4-ide;iridium(3+);propan-2-yl-[propan-2-ylazanidyl(1,2,4-triazol-1-yl)methyl]azanide |
|---|---|
| PubChem CID | 153420867 |
| Molecular Formula | C19H22F2IrN7 |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | 2,6-difluoro-3-pyridin-2-yl-4H-pyridin-4-ide;iridium(3+);propan-2-yl-[propan-2-ylazanidyl(1,2,4-triazol-1-yl)methyl]azanide |
| SMILES | CC(C)[N-]C([N-]C(C)C)n1cncn1.Fc1c[c-]c(-c2ccccn2)c(F)n1.[Ir+3] |
| InChI | InChI=1S/C10H5F2N2.C9H17N5.Ir/c11-9-5-4-7(10(12)14-9)8-3-1-2-6-13-8;1-7(2)12-9(13-8(3)4)14-6-10-5-11-14;/h1-3,5-6H;5-9H,1-4H3;/q-1;-2;+3 |
| InChIKey | JHTNOGOGAZOXEC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 84.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|