C12H5F2IrN2- — CID 58880833
2-(2,4-difluoro-3-isocyanobenzene-6-id-1-yl)pyridine;iridium (PubChem CID 58880833) has the molecular formula C12H5F2IrN2- and a molecular weight of 407.40 g/mol. Its IUPAC name is 2-(2,4-difluoro-3-isocyanobenzene-6-id-1-yl)pyridine;iridium.
| Compound Name | 2-(2,4-difluoro-3-isocyanobenzene-6-id-1-yl)pyridine;iridium |
|---|---|
| PubChem CID | 58880833 |
| Molecular Formula | C12H5F2IrN2- |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 2-(2,4-difluoro-3-isocyanobenzene-6-id-1-yl)pyridine;iridium |
| SMILES | [C-]#[N+]c1c(F)c[c-]c(-c2ccccn2)c1F.[Ir] |
| InChI | InChI=1S/C12H5F2N2.Ir/c1-15-12-9(13)6-5-8(11(12)14)10-4-2-3-7-16-10;/h2-4,6-7H;/q-1; |
| InChIKey | CZWMLCYVVQMKQK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|