C18H9F5IrN- — CID 58880821
2-[2,4-difluoro-3-[4-(trifluoromethyl)phenyl]benzene-6-id-1-yl]pyridine;iridium (PubChem CID 58880821) has the molecular formula C18H9F5IrN- and a molecular weight of 526.48 g/mol. Its IUPAC name is 2-[2,4-difluoro-3-[4-(trifluoromethyl)phenyl]benzene-6-id-1-yl]pyridine;iridium.
| Compound Name | 2-[2,4-difluoro-3-[4-(trifluoromethyl)phenyl]benzene-6-id-1-yl]pyridine;iridium |
|---|---|
| PubChem CID | 58880821 |
| Molecular Formula | C18H9F5IrN- |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | 2-[2,4-difluoro-3-[4-(trifluoromethyl)phenyl]benzene-6-id-1-yl]pyridine;iridium |
| SMILES | Fc1c[c-]c(-c2ccccn2)c(F)c1-c1ccc(C(F)(F)F)cc1.[Ir] |
| InChI | InChI=1S/C18H9F5N.Ir/c19-14-9-8-13(15-3-1-2-10-24-15)17(20)16(14)11-4-6-12(7-5-11)18(21,22)23;/h1-7,9-10H;/q-1; |
| InChIKey | ZOFKTVCTDGDPMK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|