C40H22F6N2 — CID 132519155
2-[6-pyridin-2-yl-2,7-bis[4-(trifluoromethyl)phenyl]pyren-1-yl]pyridine (PubChem CID 132519155) has the molecular formula C40H22F6N2 and a molecular weight of 644.62 g/mol. Its IUPAC name is 2-[6-pyridin-2-yl-2,7-bis[4-(trifluoromethyl)phenyl]pyren-1-yl]pyridine.
| Compound Name | 2-[6-pyridin-2-yl-2,7-bis[4-(trifluoromethyl)phenyl]pyren-1-yl]pyridine |
|---|---|
| PubChem CID | 132519155 |
| Molecular Formula | C40H22F6N2 |
| Molecular Weight | 644.62 g/mol |
| Exact Mass | 644.17 |
| IUPAC Name | 2-[6-pyridin-2-yl-2,7-bis[4-(trifluoromethyl)phenyl]pyren-1-yl]pyridine |
| SMILES | FC(F)(F)c1ccc(-c2cc3ccc4c(-c5ccccn5)c(-c5ccc(C(F)(F)F)cc5)cc5ccc(c2-c2ccccn2)c3c54)cc1 |
| InChI | InChI=1S/C40H22F6N2/c41-39(42,43)27-13-7-23(8-14-27)31-21-25-12-18-30-36-26(11-17-29(35(25)36)37(31)33-5-1-3-19-47-33)22-32(38(30)34-6-2-4-20-48-34)24-9-15-28(16-10-24)40(44,45)46/h1-22H |
| InChIKey | WBOXVWZFFMLCJL-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.62 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|