C30H16F6 — CID 122550344
4,10-bis[4-(trifluoromethyl)phenyl]pyrene (PubChem CID 122550344) has the molecular formula C30H16F6 and a molecular weight of 490.45 g/mol. Its IUPAC name is 4,10-bis[4-(trifluoromethyl)phenyl]pyrene.
| Compound Name | 4,10-bis[4-(trifluoromethyl)phenyl]pyrene |
|---|---|
| PubChem CID | 122550344 |
| Molecular Formula | C30H16F6 |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 4,10-bis[4-(trifluoromethyl)phenyl]pyrene |
| SMILES | FC(F)(F)c1ccc(-c2cc3cccc4cc(-c5ccc(C(F)(F)F)cc5)c5cccc2c5c34)cc1 |
| InChI | InChI=1S/C30H16F6/c31-29(32,33)21-11-7-17(8-12-21)25-15-19-3-1-4-20-16-26(18-9-13-22(14-10-18)30(34,35)36)24-6-2-5-23(25)28(24)27(19)20/h1-16H |
| InChIKey | IETDIAVUBGIHMA-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|