C24H13F6I — CID 86233116
1-iodo-2,4-bis[4-(trifluoromethyl)phenyl]naphthalene (PubChem CID 86233116) has the molecular formula C24H13F6I and a molecular weight of 542.26 g/mol. Its IUPAC name is 1-iodo-2,4-bis[4-(trifluoromethyl)phenyl]naphthalene.
| Compound Name | 1-iodo-2,4-bis[4-(trifluoromethyl)phenyl]naphthalene |
|---|---|
| PubChem CID | 86233116 |
| Molecular Formula | C24H13F6I |
| Molecular Weight | 542.26 g/mol |
| Exact Mass | 542.00 |
| IUPAC Name | 1-iodo-2,4-bis[4-(trifluoromethyl)phenyl]naphthalene |
| SMILES | FC(F)(F)c1ccc(-c2cc(-c3ccc(C(F)(F)F)cc3)c3ccccc3c2I)cc1 |
| InChI | InChI=1S/C24H13F6I/c25-23(26,27)16-9-5-14(6-10-16)20-13-21(22(31)19-4-2-1-3-18(19)20)15-7-11-17(12-8-15)24(28,29)30/h1-13H |
| InChIKey | MUENAMZWGHTDAG-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.26 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|