C22H12F6O — CID 11961545
1,3-bis[4-(trifluoromethyl)phenyl]-2-benzofuran (PubChem CID 11961545) has the molecular formula C22H12F6O and a molecular weight of 406.33 g/mol. Its IUPAC name is 1,3-bis[4-(trifluoromethyl)phenyl]-2-benzofuran.
| Compound Name | 1,3-bis[4-(trifluoromethyl)phenyl]-2-benzofuran |
|---|---|
| PubChem CID | 11961545 |
| Molecular Formula | C22H12F6O |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 1,3-bis[4-(trifluoromethyl)phenyl]-2-benzofuran |
| SMILES | FC(F)(F)c1ccc(-c2oc(-c3ccc(C(F)(F)F)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C22H12F6O/c23-21(24,25)15-9-5-13(6-10-15)19-17-3-1-2-4-18(17)20(29-19)14-7-11-16(12-8-14)22(26,27)28/h1-12H |
| InChIKey | UPZHPETZUMDVSS-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |