C19H11F3O3 — CID 163637979
2-methyl-3-[4-(trifluoromethyl)phenyl]furo[2,3-b]chromen-4-one (PubChem CID 163637979) has the molecular formula C19H11F3O3 and a molecular weight of 344.29 g/mol. Its IUPAC name is 2-methyl-3-[4-(trifluoromethyl)phenyl]furo[2,3-b]chromen-4-one.
| Compound Name | 2-methyl-3-[4-(trifluoromethyl)phenyl]furo[2,3-b]chromen-4-one |
|---|---|
| PubChem CID | 163637979 |
| Molecular Formula | C19H11F3O3 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-methyl-3-[4-(trifluoromethyl)phenyl]furo[2,3-b]chromen-4-one |
| SMILES | Cc1oc2oc3ccccc3c(=O)c2c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H11F3O3/c1-10-15(11-6-8-12(9-7-11)19(20,21)22)16-17(23)13-4-2-3-5-14(13)25-18(16)24-10/h2-9H,1H3 |
| InChIKey | IBVOKJSTYARSFF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |