C30H17F3O2 — CID 164686695
7-phenyl-12-[4-(trifluoromethyl)phenyl]naphtho[2,3-c]isochromen-5-one (PubChem CID 164686695) has the molecular formula C30H17F3O2 and a molecular weight of 466.46 g/mol. Its IUPAC name is 7-phenyl-12-[4-(trifluoromethyl)phenyl]naphtho[2,3-c]isochromen-5-one.
| Compound Name | 7-phenyl-12-[4-(trifluoromethyl)phenyl]naphtho[2,3-c]isochromen-5-one |
|---|---|
| PubChem CID | 164686695 |
| Molecular Formula | C30H17F3O2 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 7-phenyl-12-[4-(trifluoromethyl)phenyl]naphtho[2,3-c]isochromen-5-one |
| SMILES | O=c1oc2c(-c3ccccc3)c3ccccc3c(-c3ccc(C(F)(F)F)cc3)c2c2ccccc12 |
| InChI | InChI=1S/C30H17F3O2/c31-30(32,33)20-16-14-19(15-17-20)25-21-10-4-5-11-22(21)26(18-8-2-1-3-9-18)28-27(25)23-12-6-7-13-24(23)29(34)35-28/h1-17H |
| InChIKey | RHUXYLUBVPQFRI-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|