C26H15F5IrN4-2 — CID 58880819
2-(2,4-difluoro-3-phenylbenzene-6-id-1-yl)pyridine;iridium;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine (PubChem CID 58880819) has the molecular formula C26H15F5IrN4-2 and a molecular weight of 670.64 g/mol. Its IUPAC name is 2-(2,4-difluoro-3-phenylbenzene-6-id-1-yl)pyridine;iridium;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine.
| Compound Name | 2-(2,4-difluoro-3-phenylbenzene-6-id-1-yl)pyridine;iridium;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
|---|---|
| PubChem CID | 58880819 |
| Molecular Formula | C26H15F5IrN4-2 |
| Molecular Weight | 670.64 g/mol |
| Exact Mass | 671.09 |
| IUPAC Name | 2-(2,4-difluoro-3-phenylbenzene-6-id-1-yl)pyridine;iridium;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
| SMILES | FC(F)(F)c1cc(-c2ccccn2)[n-]n1.Fc1c[c-]c(-c2ccccn2)c(F)c1-c1ccccc1.[Ir] |
| InChI | InChI=1S/C17H10F2N.C9H5F3N3.Ir/c18-14-10-9-13(15-8-4-5-11-20-15)17(19)16(14)12-6-2-1-3-7-12;10-9(11,12)8-5-7(14-15-8)6-3-1-2-4-13-6;/h1-8,10-11H;1-5H;/q2*-1; |
| InChIKey | ZPFPWWDNIRTRAU-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 52.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.64 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|