C16H13F2IrN2- — CID 58900839
4-tert-butyl-2-(2,4-difluoro-3-isocyanobenzene-6-id-1-yl)pyridine;iridium (PubChem CID 58900839) has the molecular formula C16H13F2IrN2- and a molecular weight of 463.51 g/mol. Its IUPAC name is 4-tert-butyl-2-(2,4-difluoro-3-isocyanobenzene-6-id-1-yl)pyridine;iridium.
| Compound Name | 4-tert-butyl-2-(2,4-difluoro-3-isocyanobenzene-6-id-1-yl)pyridine;iridium |
|---|---|
| PubChem CID | 58900839 |
| Molecular Formula | C16H13F2IrN2- |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 4-tert-butyl-2-(2,4-difluoro-3-isocyanobenzene-6-id-1-yl)pyridine;iridium |
| SMILES | [C-]#[N+]c1c(F)c[c-]c(-c2cc(C(C)(C)C)ccn2)c1F.[Ir] |
| InChI | InChI=1S/C16H13F2N2.Ir/c1-16(2,3)10-7-8-20-13(9-10)11-5-6-12(17)15(19-4)14(11)18;/h6-9H,1-3H3;/q-1; |
| InChIKey | WCTZJCAKQCQFSB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|