C52H46N4Pt — CID 59358319
2-[2,6-dimethyl-4-(2-methylbutyl)phenyl]-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+);2-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide (PubChem CID 59358319) has the molecular formula C52H46N4Pt and a molecular weight of 922.05 g/mol. Its IUPAC name is 2-[2,6-dimethyl-4-(2-methylbutyl)phenyl]-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+);2-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide.
| Compound Name | 2-[2,6-dimethyl-4-(2-methylbutyl)phenyl]-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+);2-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide |
|---|---|
| PubChem CID | 59358319 |
| Molecular Formula | C52H46N4Pt |
| Molecular Weight | 922.05 g/mol |
| Exact Mass | 921.34 |
| IUPAC Name | 2-[2,6-dimethyl-4-(2-methylbutyl)phenyl]-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+);2-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide |
| SMILES | CCC(C)Cc1cc(C)c(-c2cn3c4ccccc4c4ccc[c-]c4c3n2)c(C)c1.Cc1cc(C)c(-c2cn3c4ccccc4c4ccc[c-]c4c3n2)c(C)c1.[Pt+2] |
| InChI | InChI=1S/C28H27N2.C24H19N2.Pt/c1-5-18(2)14-21-15-19(3)27(20(4)16-21)25-17-30-26-13-9-8-11-23(26)22-10-6-7-12-24(22)28(30)29-25;1-15-12-16(2)23(17(3)13-15)21-14-26-22-11-7-6-9-19(22)18-8-4-5-10-20(18)24(26)25-21;/h6-11,13,15-18H,5,14H2,1-4H3;4-9,11-14H,1-3H3;/q2*-1;+2 |
| InChIKey | DHKMKNZOMREWTK-UHFFFAOYSA-N |
| XLogP | 13.34 |
| TPSA | 34.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.05 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|