C26H32N3+ — CID 140932621
5-tert-butyl-6,9,12,12,13,13-hexamethyl-3,19-diaza-9-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2,4,6,8,10,14,16-octaene (PubChem CID 140932621) has the molecular formula C26H32N3+ and a molecular weight of 386.56 g/mol. Its IUPAC name is 5-tert-butyl-6,9,12,12,13,13-hexamethyl-3,19-diaza-9-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2,4,6,8,10,14,16-octaene.
| Compound Name | 5-tert-butyl-6,9,12,12,13,13-hexamethyl-3,19-diaza-9-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2,4,6,8,10,14,16-octaene |
|---|---|
| PubChem CID | 140932621 |
| Molecular Formula | C26H32N3+ |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | 5-tert-butyl-6,9,12,12,13,13-hexamethyl-3,19-diaza-9-azoniapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(18),2,4,6,8,10,14,16-octaene |
| SMILES | Cc1c(C(C)(C)C)cnc2c3cccc4c3n3c(c[n+](C)c3c12)C(C)(C)C4(C)C |
| InChI | InChI=1S/C26H32N3/c1-15-18(24(2,3)4)13-27-21-16-11-10-12-17-22(16)29-19(26(7,8)25(17,5)6)14-28(9)23(29)20(15)21/h10-14H,1-9H3/q+1 |
| InChIKey | YZRBKFNWQAYPNW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|