C22H22N2 — CID 140855336
10-deuterio-12,12,13,13,17-pentamethyl-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,8,10,14(18),15-octaene (PubChem CID 140855336) has the molecular formula C22H22N2 and a molecular weight of 315.44 g/mol. Its IUPAC name is 10-deuterio-12,12,13,13,17-pentamethyl-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,8,10,14(18),15-octaene.
| Compound Name | 10-deuterio-12,12,13,13,17-pentamethyl-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,8,10,14(18),15-octaene |
|---|---|
| PubChem CID | 140855336 |
| Molecular Formula | C22H22N2 |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 10-deuterio-12,12,13,13,17-pentamethyl-9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,8,10,14(18),15-octaene |
| SMILES | [2H]c1nc2c3ccccc3c3c(C)ccc4c3n2c1C(C)(C)C4(C)C |
| InChI | InChI=1S/C22H22N2/c1-13-10-11-16-19-18(13)14-8-6-7-9-15(14)20-23-12-17(24(19)20)22(4,5)21(16,2)3/h6-12H,1-5H3/i12D |
| InChIKey | NDLGONNARXVSPV-UQBWLURTSA-N |
| XLogP | 5.52 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|