C52H48IrN4-2 — CID 156667274
CID 156667274 (PubChem CID 156667274) has the molecular formula C52H48IrN4-2 and a molecular weight of 924.22 g/mol.
| Compound Name | CID 156667274 |
|---|---|
| PubChem CID | 156667274 |
| Molecular Formula | C52H48IrN4-2 |
| Molecular Weight | 924.22 g/mol |
| Exact Mass | 924.37 |
| IUPAC Name | — |
| SMILES | CC1(C)c2cccc3c4ccc[c-]c4c4ncc(n4c23)C1(C)C.[2H]C([2H])([2H])c1ccc2c3c1c1ccc[c-]c1c1nc4c(n13)C(C)(CC(C)(C)c1ccccc1-4)C2(C)C.[Ir] |
| InChI | InChI=1S/C31H29N2.C21H19N2.Ir/c1-18-15-16-23-26-24(18)19-11-7-8-12-20(19)28-32-25-21-13-9-10-14-22(21)29(2,3)17-31(6,30(23,4)5)27(25)33(26)28;1-20(2)16-11-7-10-14-13-8-5-6-9-15(13)19-22-12-17(21(20,3)4)23(19)18(14)16;/h7-11,13-16H,17H2,1-6H3;5-8,10-12H,1-4H3;/q2*-1;/i1D3;; |
| InChIKey | OVDFYUQSWJSUPL-GXXYEPOPSA-N |
| XLogP | 12.65 |
| TPSA | 34.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.22 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|