C31H29N2+ — CID 158641918
8,8,9,11,11-pentamethyl-1-aza-19-azoniaoctacyclo[16.9.1.02,7.03,25.09,28.012,17.019,27.021,26]octacosa-2,4,6,12,14,16,18(28),19(27),21(26),22,24-undecaene (PubChem CID 158641918) has the molecular formula C31H29N2+ and a molecular weight of 429.59 g/mol. Its IUPAC name is 8,8,9,11,11-pentamethyl-1-aza-19-azoniaoctacyclo[16.9.1.02,7.03,25.09,28.012,17.019,27.021,26]octacosa-2,4,6,12,14,16,18(28),19(27),21(26),22,24-undecaene.
| Compound Name | 8,8,9,11,11-pentamethyl-1-aza-19-azoniaoctacyclo[16.9.1.02,7.03,25.09,28.012,17.019,27.021,26]octacosa-2,4,6,12,14,16,18(28),19(27),21(26),22,24-undecaene |
|---|---|
| PubChem CID | 158641918 |
| Molecular Formula | C31H29N2+ |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 8,8,9,11,11-pentamethyl-1-aza-19-azoniaoctacyclo[16.9.1.02,7.03,25.09,28.012,17.019,27.021,26]octacosa-2,4,6,12,14,16,18(28),19(27),21(26),22,24-undecaene |
| SMILES | CC1(C)CC2(C)c3c([n+]4c5c6c(cccc6c6cccc(c6n35)C2(C)C)C4)-c2ccccc21 |
| InChI | InChI=1S/C31H29N2/c1-29(2)17-31(5)27-26(21-11-6-7-14-22(21)29)32-16-18-10-8-12-19-20-13-9-15-23(30(31,3)4)25(20)33(27)28(32)24(18)19/h6-15H,16-17H2,1-5H3/q+1 |
| InChIKey | WULWXNZKECLIQE-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|