C19H17N2Si+ — CID 157199849
13,13-dimethyl-1-aza-10-azonia-13-silahexacyclo[10.8.0.02,10.03,8.04,19.015,20]icosa-2(10),3(8),4,6,11,15(20),16,18-octaene (PubChem CID 157199849) has the molecular formula C19H17N2Si+ and a molecular weight of 301.44 g/mol. Its IUPAC name is 13,13-dimethyl-1-aza-10-azonia-13-silahexacyclo[10.8.0.02,10.03,8.04,19.015,20]icosa-2(10),3(8),4,6,11,15(20),16,18-octaene.
| Compound Name | 13,13-dimethyl-1-aza-10-azonia-13-silahexacyclo[10.8.0.02,10.03,8.04,19.015,20]icosa-2(10),3(8),4,6,11,15(20),16,18-octaene |
|---|---|
| PubChem CID | 157199849 |
| Molecular Formula | C19H17N2Si+ |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 13,13-dimethyl-1-aza-10-azonia-13-silahexacyclo[10.8.0.02,10.03,8.04,19.015,20]icosa-2(10),3(8),4,6,11,15(20),16,18-octaene |
| SMILES | C[Si]1(C)Cc2cccc3c4cccc5c4c4n(c1c[n+]4C5)c23 |
| InChI | InChI=1S/C19H17N2Si/c1-22(2)11-13-6-4-8-15-14-7-3-5-12-9-20-10-16(22)21(18(13)15)19(20)17(12)14/h3-8,10H,9,11H2,1-2H3/q+1 |
| InChIKey | GDRHAWIBVLJBFH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|