C30H27N2O4+ — CID 59365920
3-[2,6-bis(1,3-dioxan-2-yl)phenyl]-4-aza-1-azoniapentacyclo[13.2.1.04,17.05,10.011,16]octadeca-1(17),2,5,7,9,11,13,15-octaene (PubChem CID 59365920) has the molecular formula C30H27N2O4+ and a molecular weight of 479.56 g/mol. Its IUPAC name is 3-[2,6-bis(1,3-dioxan-2-yl)phenyl]-4-aza-1-azoniapentacyclo[13.2.1.04,17.05,10.011,16]octadeca-1(17),2,5,7,9,11,13,15-octaene.
| Compound Name | 3-[2,6-bis(1,3-dioxan-2-yl)phenyl]-4-aza-1-azoniapentacyclo[13.2.1.04,17.05,10.011,16]octadeca-1(17),2,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 59365920 |
| Molecular Formula | C30H27N2O4+ |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 3-[2,6-bis(1,3-dioxan-2-yl)phenyl]-4-aza-1-azoniapentacyclo[13.2.1.04,17.05,10.011,16]octadeca-1(17),2,5,7,9,11,13,15-octaene |
| SMILES | c1cc(C2OCCCO2)c(-c2c[n+]3c4c5c(cccc5c5ccccc5n24)C3)c(C2OCCCO2)c1 |
| InChI | InChI=1S/C30H27N2O4/c1-2-12-24-20(8-1)21-9-3-7-19-17-31-18-25(32(24)28(31)26(19)21)27-22(29-33-13-5-14-34-29)10-4-11-23(27)30-35-15-6-16-36-30/h1-4,7-12,18,29-30H,5-6,13-17H2/q+1 |
| InChIKey | RLWNNNHTXMBQDB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 45.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|