C15H10BN3+2 — CID 160923282
CID 160923282 (PubChem CID 160923282) has the molecular formula C15H10BN3+2 and a molecular weight of 243.08 g/mol.
| Compound Name | CID 160923282 |
|---|---|
| PubChem CID | 160923282 |
| Molecular Formula | C15H10BN3+2 |
| Molecular Weight | 243.08 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | — |
| SMILES | [B][n+]1c[n+]2c3c4c(cccc4c4ccccc4n31)C2 |
| InChI | InChI=1S/C15H10BN3/c16-18-9-17-8-10-4-3-6-12-11-5-1-2-7-13(11)19(18)15(17)14(10)12/h1-7,9H,8H2/q+2 |
| InChIKey | UPYQTKYGAFZMQE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 12.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.08 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|