About CID 160923282
CID 160923282 (PubChem CID 160923282) has the molecular formula C15H10BN3+2
and a molecular weight of 243.08 g/mol.
Molecular Properties
| Compound Name | CID 160923282 |
| PubChem CID | 160923282 |
| Molecular Formula | C15H10BN3+2 |
| Molecular Weight | 243.08 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | — |
| SMILES | [B][n+]1c[n+]2c3c4c(cccc4c4ccccc4n31)C2 |
| InChI | InChI=1S/C15H10BN3/c16-18-9-17-8-10-4-3-6-12-11-5-1-2-7-13(11)19(18)15(17)14(10)12/h1-7,9H,8H2/q+2 |
| InChIKey | UPYQTKYGAFZMQE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 12.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.08 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 160923282 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 160923282?
The IUPAC name of CID 160923282 (CID 160923282) is not available.
What is the SMILES notation for CID 160923282?
The canonical SMILES for CID 160923282 is [B][n+]1c[n+]2c3c4c(cccc4c4ccccc4n31)C2.
What is the InChIKey of CID 160923282?
The InChIKey is UPYQTKYGAFZMQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BN3/c16-18-9-17-8-10-4-3-6-12-11-5-1-2-7-13(11)19(18)15(17)14(10)12/h1-7,9H,8H2/q+2.
What are the key properties of CID 160923282?
CID 160923282 has a molecular weight of 243.08 g/mol, XLogP of 1.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 160923282 is sourced from PubChem (CID 160923282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).