C15H10BrN — CID 139798494
3-bromo-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5(16),6,8,10,12,14-heptaene (PubChem CID 139798494) has the molecular formula C15H10BrN and a molecular weight of 284.16 g/mol. Its IUPAC name is 3-bromo-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5(16),6,8,10,12,14-heptaene.
| Compound Name | 3-bromo-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5(16),6,8,10,12,14-heptaene |
|---|---|
| PubChem CID | 139798494 |
| Molecular Formula | C15H10BrN |
| Molecular Weight | 284.16 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 3-bromo-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5(16),6,8,10,12,14-heptaene |
| SMILES | BrC1=Cn2c3ccccc3c3cccc(c32)C1 |
| InChI | InChI=1S/C15H10BrN/c16-11-8-10-4-3-6-13-12-5-1-2-7-14(12)17(9-11)15(10)13/h1-7,9H,8H2 |
| InChIKey | ZJWIHGJVZLMESC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.16 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |