C17H12N3+ — CID 159271859
1,16-diaza-10-azoniahexacyclo[10.8.0.02,10.03,8.04,19.015,20]icosa-2(10),3(8),4,6,11,15,17,19-octaene (PubChem CID 159271859) has the molecular formula C17H12N3+ and a molecular weight of 258.30 g/mol. Its IUPAC name is 1,16-diaza-10-azoniahexacyclo[10.8.0.02,10.03,8.04,19.015,20]icosa-2(10),3(8),4,6,11,15,17,19-octaene.
| Compound Name | 1,16-diaza-10-azoniahexacyclo[10.8.0.02,10.03,8.04,19.015,20]icosa-2(10),3(8),4,6,11,15,17,19-octaene |
|---|---|
| PubChem CID | 159271859 |
| Molecular Formula | C17H12N3+ |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1,16-diaza-10-azoniahexacyclo[10.8.0.02,10.03,8.04,19.015,20]icosa-2(10),3(8),4,6,11,15,17,19-octaene |
| SMILES | c1cc2c3c(c1)c1ccnc4c1n1c(c[n+](c31)C2)CC4 |
| InChI | InChI=1S/C17H12N3/c1-2-10-8-19-9-11-4-5-14-16-13(6-7-18-14)12(3-1)15(10)17(19)20(11)16/h1-3,6-7,9H,4-5,8H2/q+1 |
| InChIKey | SOSAMRNMXGIUBE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|