About 4-azatricyclo[5.4.0.03,8]undeca-1(7),3,5,8,10-pentaene
4-azatricyclo[5.4.0.03,8]undeca-1(7),3,5,8,10-pentaene (PubChem CID 45079891) has the molecular formula C10H7N
and a molecular weight of 141.17 g/mol. Its IUPAC name is 4-azatricyclo[5.4.0.03,8]undeca-1(7),3,5,8,10-pentaene.
Analyze 4-azatricyclo[5.4.0.03,8]undeca-1(7),3,5,8,10-pentaene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azatricyclo[5.4.0.03,8]undeca-1(7),3,5,8,10-pentaene?
The IUPAC name of 4-azatricyclo[5.4.0.03,8]undeca-1(7),3,5,8,10-pentaene (CID 45079891) is 4-azatricyclo[5.4.0.03,8]undeca-1(7),3,5,8,10-pentaene.
What is the SMILES notation for 4-azatricyclo[5.4.0.03,8]undeca-1(7),3,5,8,10-pentaene?
The canonical SMILES for 4-azatricyclo[5.4.0.03,8]undeca-1(7),3,5,8,10-pentaene is c1cc2c3ccnc(c3c1)C2.
What is the InChIKey of 4-azatricyclo[5.4.0.03,8]undeca-1(7),3,5,8,10-pentaene?
The InChIKey is KDXXZIJQXTWOLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N/c1-2-7-6-10-9(3-1)8(7)4-5-11-10/h1-5H,6H2.
What are the key properties of 4-azatricyclo[5.4.0.03,8]undeca-1(7),3,5,8,10-pentaene?
4-azatricyclo[5.4.0.03,8]undeca-1(7),3,5,8,10-pentaene has a molecular weight of 141.17 g/mol, XLogP of 2.14, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azatricyclo[5.4.0.03,8]undeca-1(7),3,5,8,10-pentaene is sourced from PubChem (CID 45079891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).