C46H38N4Pt — CID 155643332
CID 155643332 (PubChem CID 155643332) has the molecular formula C46H38N4Pt and a molecular weight of 841.92 g/mol.
| Compound Name | CID 155643332 |
|---|---|
| PubChem CID | 155643332 |
| Molecular Formula | C46H38N4Pt |
| Molecular Weight | 841.92 g/mol |
| Exact Mass | 841.27 |
| IUPAC Name | — |
| SMILES | CC1(C)c2cccc3c4ccc(-c5cccc6cc7c([c-]c56)c5ncc6n5c5c(cccc75)C(C)(C)C6(C)C)[c-]c4c4ncc(n4c23)C1(C)C.[Pt+2] |
| InChI | InChI=1S/C46H38N4.Pt/c1-43(2)35-16-10-14-29-28-19-18-26(21-33(28)41-47-23-37(45(43,5)6)49(41)39(29)35)27-13-9-12-25-20-32-30-15-11-17-36-40(30)50-38(46(7,8)44(36,3)4)24-48-42(50)34(32)22-31(25)27;/h9-20,23-24H,1-8H3;/q-2;+2 |
| InChIKey | KILJODFYDJFVNB-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 34.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.92 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|