C37H32N6OPt — CID 166010749
CID 166010749 (PubChem CID 166010749) has the molecular formula C37H32N6OPt and a molecular weight of 771.78 g/mol.
| Compound Name | CID 166010749 |
|---|---|
| PubChem CID | 166010749 |
| Molecular Formula | C37H32N6OPt |
| Molecular Weight | 771.78 g/mol |
| Exact Mass | 771.23 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c3c1c1ccc(Oc4[c-]c(N5C6=NCCCN6c6cccnc65)ccc4)[c-]c1c1ncc(n13)C(C)(C)C2(C)C.[Pt+2] |
| InChI | InChI=1S/C37H32N6O.Pt/c1-22-12-15-28-32-31(22)26-14-13-25(20-27(26)33-40-21-30(43(32)33)37(4,5)36(28,2)3)44-24-10-6-9-23(19-24)42-34-29(11-7-16-38-34)41-18-8-17-39-35(41)42;/h6-7,9-16,21H,8,17-18H2,1-5H3;/q-2;+2 |
| InChIKey | AODADOBQBNBSGY-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 58.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.78 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|