C52H42BN5OPt — CID 156623079
CID 156623079 (PubChem CID 156623079) has the molecular formula C52H42BN5OPt and a molecular weight of 958.83 g/mol.
| Compound Name | CID 156623079 |
|---|---|
| PubChem CID | 156623079 |
| Molecular Formula | C52H42BN5OPt |
| Molecular Weight | 958.83 g/mol |
| Exact Mass | 958.31 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1B1N(c2ccccc2)c2cccnc2N1c1[c-]c(Oc2[c-]c3c(cc2)c2cccc4c2n2c(c(-c5ccccc5)nc32)C(C)(C)C4(C)C)ccc1.[Pt+2] |
| InChI | InChI=1S/C52H42BN5O.Pt/c1-33-17-13-18-34(2)45(33)53-57(36-21-11-8-12-22-36)44-27-16-30-54-50(44)58(53)37-23-14-24-38(31-37)59-39-28-29-40-41-25-15-26-43-47(41)56-48(52(5,6)51(43,3)4)46(35-19-9-7-10-20-35)55-49(56)42(40)32-39;/h7-30H,1-6H3;/q-2;+2 |
| InChIKey | BJJJEVZRHJBQTQ-UHFFFAOYSA-N |
| XLogP | 11.96 |
| TPSA | 45.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 958.83 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|