About CID 164704052
CID 164704052 (PubChem CID 164704052) has the molecular formula C46H29N5OPd
and a molecular weight of 774.19 g/mol.
Molecular Properties
| Compound Name | CID 164704052 |
| PubChem CID | 164704052 |
| Molecular Formula | C46H29N5OPd |
| Molecular Weight | 774.19 g/mol |
| Exact Mass | 773.14 |
| IUPAC Name | — |
| SMILES | CC1(C)c2ccc(Oc3[c-]c4c(cc3)c3ncccc3n3c(-c5ccccc5)c(-c5ccccc5)nc43)[c-]c2-n2c3ncccc3c3cccc1c32.[Pd+2] |
| InChI | InChI=1S/C46H29N5O.Pd/c1-46(2)36-23-21-31(27-39(36)51-43-33(16-9-18-37(43)46)34-17-10-25-48-44(34)51)52-30-20-22-32-35(26-30)45-49-40(28-12-5-3-6-13-28)42(29-14-7-4-8-15-29)50(45)38-19-11-24-47-41(32)38;/h3-25H,1-2H3;/q-2;+2 |
| InChIKey | RUGHUDLOUICMTF-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 774.19 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 164704052 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164704052?
The IUPAC name of CID 164704052 (CID 164704052) is not available.
What is the SMILES notation for CID 164704052?
The canonical SMILES for CID 164704052 is CC1(C)c2ccc(Oc3[c-]c4c(cc3)c3ncccc3n3c(-c5ccccc5)c(-c5ccccc5)nc43)[c-]c2-n2c3ncccc3c3cccc1c32.[Pd+2].
What is the InChIKey of CID 164704052?
The InChIKey is RUGHUDLOUICMTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H29N5O.Pd/c1-46(2)36-23-21-31(27-39(36)51-43-33(16-9-18-37(43)46)34-17-10-25-48-44(34)51)52-30-20-22-32-35(26-30)45-49-40(28-12-5-3-6-13-28)42(29-14-7-4-8-15-29)50(45)38-19-11-24-47-41(32)38;/h3-25H,1-2H3;/q-2;+2.
What are the key properties of CID 164704052?
CID 164704052 has a molecular weight of 774.19 g/mol, XLogP of 10.89, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164704052 is sourced from PubChem (CID 164704052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).