About CID 164704066
CID 164704066 (PubChem CID 164704066) has the molecular formula C41H26N4OPd
and a molecular weight of 697.11 g/mol.
Molecular Properties
| Compound Name | CID 164704066 |
| PubChem CID | 164704066 |
| Molecular Formula | C41H26N4OPd |
| Molecular Weight | 697.11 g/mol |
| Exact Mass | 696.11 |
| IUPAC Name | — |
| SMILES | CC1(C)c2cccnc2-n2c3[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n4cc(-c6ccccc6)nc54)ccc3c3cccc1c32.[Pd+2] |
| InChI | InChI=1S/C41H26N4O.Pd/c1-41(2)33-14-8-13-31-30-20-18-27(23-37(30)45(38(31)33)40-34(41)15-9-21-42-40)46-26-17-19-28-29-12-6-7-16-36(29)44-24-35(25-10-4-3-5-11-25)43-39(44)32(28)22-26;/h3-21,24H,1-2H3;/q-2;+2 |
| InChIKey | QNZGGASEJCFBGL-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 697.11 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 164704066 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164704066?
The IUPAC name of CID 164704066 (CID 164704066) is not available.
What is the SMILES notation for CID 164704066?
The canonical SMILES for CID 164704066 is CC1(C)c2cccnc2-n2c3[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n4cc(-c6ccccc6)nc54)ccc3c3cccc1c32.[Pd+2].
What is the InChIKey of CID 164704066?
The InChIKey is QNZGGASEJCFBGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C41H26N4O.Pd/c1-41(2)33-14-8-13-31-30-20-18-27(23-37(30)45(38(31)33)40-34(41)15-9-21-42-40)46-26-17-19-28-29-12-6-7-16-36(29)44-24-35(25-10-4-3-5-11-25)43-39(44)32(28)22-26;/h3-21,24H,1-2H3;/q-2;+2.
What are the key properties of CID 164704066?
CID 164704066 has a molecular weight of 697.11 g/mol, XLogP of 9.83, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164704066 is sourced from PubChem (CID 164704066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).