C33H28N3O2Pt- — CID 176606866
CID 176606866 (PubChem CID 176606866) has the molecular formula C33H28N3O2Pt- and a molecular weight of 693.68 g/mol.
| Compound Name | CID 176606866 |
|---|---|
| PubChem CID | 176606866 |
| Molecular Formula | C33H28N3O2Pt- |
| Molecular Weight | 693.68 g/mol |
| Exact Mass | 693.18 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(O)c2nc(Oc3[c-]c4c(cc3)c3cccc5c3n4-c3ncccc3C5(C)C)ccc12.[Pt] |
| InChI | InChI=1S/C33H28N3O2.Pt/c1-32(2,3)23-14-15-27(37)29-22(23)13-16-28(35-29)38-19-11-12-20-21-8-6-9-24-30(21)36(26(20)18-19)31-25(33(24,4)5)10-7-17-34-31;/h6-17,37H,1-5H3;/q-1; |
| InChIKey | HUGONWBUXWCNBH-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.68 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|