C31H25N3OPtS — CID 176606440
5-tert-butyl-2-[[9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinoline-8-thiolate;platinum(2+) (PubChem CID 176606440) has the molecular formula C31H25N3OPtS and a molecular weight of 682.71 g/mol. Its IUPAC name is 5-tert-butyl-2-[[9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinoline-8-thiolate;platinum(2+).
| Compound Name | 5-tert-butyl-2-[[9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinoline-8-thiolate;platinum(2+) |
|---|---|
| PubChem CID | 176606440 |
| Molecular Formula | C31H25N3OPtS |
| Molecular Weight | 682.71 g/mol |
| Exact Mass | 682.14 |
| IUPAC Name | 5-tert-butyl-2-[[9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]quinoline-8-thiolate;platinum(2+) |
| SMILES | Cc1ccnc(-n2c3[c-]c(Oc4ccc5c(C(C)(C)C)ccc([S-])c5n4)ccc3c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C31H26N3OS.Pt/c1-19-15-16-32-28(17-19)34-25-8-6-5-7-21(25)22-10-9-20(18-26(22)34)35-29-14-11-23-24(31(2,3)4)12-13-27(36)30(23)33-29;/h5-17,36H,1-4H3;/q-1;+2/p-1 |
| InChIKey | LSOWEDMUOHAKPG-UHFFFAOYSA-M |
| XLogP | 7.83 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.71 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|