C32H28N3OPt- — CID 176606633
5-tert-butyl-2-[[9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]methyl]quinolin-8-ol;platinum (PubChem CID 176606633) has the molecular formula C32H28N3OPt- and a molecular weight of 665.67 g/mol. Its IUPAC name is 5-tert-butyl-2-[[9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]methyl]quinolin-8-ol;platinum.
| Compound Name | 5-tert-butyl-2-[[9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]methyl]quinolin-8-ol;platinum |
|---|---|
| PubChem CID | 176606633 |
| Molecular Formula | C32H28N3OPt- |
| Molecular Weight | 665.67 g/mol |
| Exact Mass | 665.19 |
| IUPAC Name | 5-tert-butyl-2-[[9-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]methyl]quinolin-8-ol;platinum |
| SMILES | Cc1ccnc(-n2c3[c-]c(Cc4ccc5c(C(C)(C)C)ccc(O)c5n4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C32H28N3O.Pt/c1-20-15-16-33-30(17-20)35-27-8-6-5-7-23(27)24-11-9-21(19-28(24)35)18-22-10-12-25-26(32(2,3)4)13-14-29(36)31(25)34-22;/h5-17,36H,18H2,1-4H3;/q-1; |
| InChIKey | HHVSNHKICPSPAK-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.67 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|