C29H23N4O2Pt- — CID 176605947
2-[[9-[4-(dimethylamino)-2-pyridinyl]-1H-carbazol-1-id-2-yl]oxy]-4-methylquinolin-8-ol;platinum (PubChem CID 176605947) has the molecular formula C29H23N4O2Pt- and a molecular weight of 654.61 g/mol. Its IUPAC name is 2-[[9-[4-(dimethylamino)-2-pyridinyl]-1H-carbazol-1-id-2-yl]oxy]-4-methylquinolin-8-ol;platinum.
| Compound Name | 2-[[9-[4-(dimethylamino)-2-pyridinyl]-1H-carbazol-1-id-2-yl]oxy]-4-methylquinolin-8-ol;platinum |
|---|---|
| PubChem CID | 176605947 |
| Molecular Formula | C29H23N4O2Pt- |
| Molecular Weight | 654.61 g/mol |
| Exact Mass | 654.15 |
| IUPAC Name | 2-[[9-[4-(dimethylamino)-2-pyridinyl]-1H-carbazol-1-id-2-yl]oxy]-4-methylquinolin-8-ol;platinum |
| SMILES | Cc1cc(Oc2[c-]c3c(cc2)c2ccccc2n3-c2cc(N(C)C)ccn2)nc2c(O)cccc12.[Pt] |
| InChI | InChI=1S/C29H23N4O2.Pt/c1-18-15-28(31-29-21(18)8-6-10-26(29)34)35-20-11-12-23-22-7-4-5-9-24(22)33(25(23)17-20)27-16-19(32(2)3)13-14-30-27;/h4-16,34H,1-3H3;/q-1; |
| InChIKey | PLEUVMZMZZDNHX-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.61 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|